CAS 1858240-51-3 is the registry number for N-Benzyl-2-chloro-n-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-benzyl-2-chloro-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide (CAS 1858240-51-3) is a chemical compound with the molecular formula C19H17ClN2O3 and a molecular weight of 356.8 g/mol. IUPAC name: N-benzyl-2-chloro-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide. InChIKey: KHABPCYGZDILDA-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O3 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | N-benzyl-2-chloro-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)acetamide |
| InChIKey | KHABPCYGZDILDA-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1=O)C2=CC=CC=C2)N(CC3=CC=CC=C3)C(=O)CCl |
Computed by PubChem (NCBI)