CAS 121433-36-1 is the registry number for 2,4-Diaminoisoindole-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2,4-diaminoisoindole-1,3-dione (CAS 121433-36-1) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 2,4-diaminoisoindole-1,3-dione. InChIKey: OFWOUIMOCCPPGO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2,4-diaminoisoindole-1,3-dione |
| InChIKey | OFWOUIMOCCPPGO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)N(C2=O)N |
Computed by PubChem (NCBI)