Products 900027-15-8
CAS 900027-15-8 appears in our catalog under these names: 3-[4-Chloro-3-(trifluoromethyl)phenyl]propionic acid, 98%, 3-(4-Chloro-3-(trifluoromethyl)-phenyl)propionic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-[4-chloro-3-(trifluoromethyl)phenyl]propanoic acid (CAS 900027-15-8) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: 3-[4-chloro-3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: AZZBPLHKSLMVJM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | 3-[4-chloro-3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | AZZBPLHKSLMVJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)