Products 1214352-75-6
CAS 1214352-75-6 is the registry number for 1-bromo-5-chloro-4-(difluoromethyl)-2-fluorobenzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-5-chloro-4-(difluoromethyl)-2-fluorobenzene (CAS 1214352-75-6) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 1-bromo-5-chloro-4-(difluoromethyl)-2-fluorobenzene. InChIKey: LESYBLJSPBMSQB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 1-bromo-5-chloro-4-(difluoromethyl)-2-fluorobenzene |
| InChIKey | LESYBLJSPBMSQB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)Cl)C(F)F |
Computed by PubChem (NCBI)