CAS 1214356-46-3 is the registry number for 2,5-Di(pyridin-4-yl)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-dipyridin-4-ylphenol (CAS 1214356-46-3) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 2,5-dipyridin-4-ylphenol. InChIKey: HUMIBDSEOZDIKH-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 2,5-dipyridin-4-ylphenol |
| InChIKey | HUMIBDSEOZDIKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=NC=C2)O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)