CAS 121436-48-4 appears in our catalog under these names: N,N-Diethyl-2-imino-2,3-dihydro-1,3-benzothiazol-6-amine, 95%, N,N-Diethyl-2-imino-2,3-dihydro-1,3-benzothiazol-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-N,6-N-diethyl-1,3-benzothiazole-2,6-diamine (CAS 121436-48-4) is a chemical compound with the molecular formula C11H15N3S and a molecular weight of 221.32 g/mol. IUPAC name: 6-N,6-N-diethyl-1,3-benzothiazole-2,6-diamine. InChIKey: HVEZEMFGHFXXHV-UHFFFAOYSA-N.
| Molecular formula | C11H15N3S |
|---|---|
| Molecular weight | 221.32 g/mol |
| IUPAC name | 6-N,6-N-diethyl-1,3-benzothiazole-2,6-diamine |
| InChIKey | HVEZEMFGHFXXHV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)N=C(S2)N |
Computed by PubChem (NCBI)