CAS 1214366-76-3 appears in our catalog under these names: 4-Bromo-2-methoxybenzoic acid ethyl ester, 95%, Ethyl 4-bromo-2-methoxybenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 4-bromo-2-methoxybenzoate (CAS 1214366-76-3) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: ethyl 4-bromo-2-methoxybenzoate. InChIKey: KIJFCXXSVUJWAA-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | ethyl 4-bromo-2-methoxybenzoate |
| InChIKey | KIJFCXXSVUJWAA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)Br)OC |
Computed by PubChem (NCBI)