CAS 1214368-27-0 appears in our catalog under these names: 3-Fluoro-5-(pyridin-4-yl)benzoic acid, 98%, 3-Fluoro-5-(4-pyridinyl)benzoic acid, 98%, 98%, 3-Fluoro-5-(4-pyridinyl)benzoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-fluoro-5-pyridin-4-ylbenzoic acid (CAS 1214368-27-0) is a chemical compound with the molecular formula C12H8FNO2 and a molecular weight of 217.20 g/mol. IUPAC name: 3-fluoro-5-pyridin-4-ylbenzoic acid. InChIKey: KVCSQFBCARNYOZ-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO2 |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 3-fluoro-5-pyridin-4-ylbenzoic acid |
| InChIKey | KVCSQFBCARNYOZ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)