CAS 1214377-79-3 is the registry number for Ethyl 3-bromo-6-hydroxypicolinate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 3-bromo-6-oxo-1H-pyridine-2-carboxylate (CAS 1214377-79-3) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: ethyl 3-bromo-6-oxo-1H-pyridine-2-carboxylate. InChIKey: RPYJORIDPWCWOY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | ethyl 3-bromo-6-oxo-1H-pyridine-2-carboxylate |
| InChIKey | RPYJORIDPWCWOY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=O)N1)Br |
Computed by PubChem (NCBI)