Products 1214379-18-6
CAS 1214379-18-6 appears in our catalog under these names: Ethyl 2-fluoro-3-nitrobenzoate, 98%, 2-Fluoro-3-nitrobenzoic acid ethyl ester, Ethyl 2-fluoro-3-nitrobenzoate, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 100mg, 250mg.
Ethyl 2-fluoro-3-nitrobenzoate (CAS 1214379-18-6) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 2-fluoro-3-nitrobenzoate. InChIKey: MFXTZNGCDRNCKK-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 2-fluoro-3-nitrobenzoate |
| InChIKey | MFXTZNGCDRNCKK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)