CAS 1214379-24-4 is the registry number for Ethyl 6-bromo-2-fluoronicotinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Ethyl 6-bromo-2-fluoropyridine-3-carboxylate (CAS 1214379-24-4) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: ethyl 6-bromo-2-fluoropyridine-3-carboxylate. InChIKey: NPSFOUUEENRBCG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | ethyl 6-bromo-2-fluoropyridine-3-carboxylate |
| InChIKey | NPSFOUUEENRBCG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)Br)F |
Computed by PubChem (NCBI)