Products 1214383-34-2
CAS 1214383-34-2 is the registry number for 1-Chloro-2-(difluoromethyl)-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-chloro-2-(difluoromethyl)-4-(trifluoromethyl)benzene (CAS 1214383-34-2) is a chemical compound with the molecular formula C8H4ClF5 and a molecular weight of 230.56 g/mol. IUPAC name: 1-chloro-2-(difluoromethyl)-4-(trifluoromethyl)benzene. InChIKey: LOJJRQOHAPHBJX-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF5 |
|---|---|
| Molecular weight | 230.56 g/mol |
| IUPAC name | 1-chloro-2-(difluoromethyl)-4-(trifluoromethyl)benzene |
| InChIKey | LOJJRQOHAPHBJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)F)Cl |
Computed by PubChem (NCBI)