CAS 1803585-20-7 appears in our catalog under these names: 1-(Chloromethyl)-2,5-difluoro-4-(trifluoromethyl)benzene, 95%, 1-(Chloromethyl)-2,5-difluoro-4-(trifluoromethyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(chloromethyl)-2,5-difluoro-4-(trifluoromethyl)benzene (CAS 1803585-20-7) is a chemical compound with the molecular formula C8H4ClF5 and a molecular weight of 230.56 g/mol. IUPAC name: 1-(chloromethyl)-2,5-difluoro-4-(trifluoromethyl)benzene. InChIKey: IJQSHVIPDFBCDF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF5 |
|---|---|
| Molecular weight | 230.56 g/mol |
| IUPAC name | 1-(chloromethyl)-2,5-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | IJQSHVIPDFBCDF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(F)(F)F)F)CCl |
Computed by PubChem (NCBI)