CAS 1357624-18-0 is the registry number for 1-(Chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene (CAS 1357624-18-0) is a chemical compound with the molecular formula C8H4ClF5 and a molecular weight of 230.56 g/mol. IUPAC name: 1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene. InChIKey: UMLZVJDTUUXSJF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF5 |
|---|---|
| Molecular weight | 230.56 g/mol |
| IUPAC name | 1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | UMLZVJDTUUXSJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CCl)F)F)C(F)(F)F |
Computed by PubChem (NCBI)