CAS 1214875-29-2 appears in our catalog under these names: 1-Bromo-6-chloroimidazo(1,5-a)pyrazine, 1-Bromo-6-chloroimidazo(1,5-a)pyrazine, 95%. Offered by: TRC, AmBeed. Available pack sizes: 50mg, 1g, 250mg.
1-bromo-6-chloroimidazo[1,5-a]pyrazine (CAS 1214875-29-2) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 1-bromo-6-chloroimidazo[1,5-a]pyrazine. InChIKey: KBXCMDVFWACMSQ-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 1-bromo-6-chloroimidazo[1,5-a]pyrazine |
| InChIKey | KBXCMDVFWACMSQ-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=C(N=CN21)Br)Cl |
Computed by PubChem (NCBI)