Products 1214899-93-0

CAS 1214899-93-0 is the registry number for 2-(trans-4-Aminocyclohexyl)propan-2-ol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-aminocyclohexyl)propan-2-ol;hydrochloride (CAS 1214899-93-0) is a chemical compound with the molecular formula C9H20ClNO and a molecular weight of 193.71 g/mol. IUPAC name: 2-(4-aminocyclohexyl)propan-2-ol;hydrochloride. InChIKey: BMAQQHDLYHZJFN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20ClNO
Molecular weight193.71 g/mol
IUPAC name2-(4-aminocyclohexyl)propan-2-ol;hydrochloride
InChIKeyBMAQQHDLYHZJFN-UHFFFAOYSA-N
SMILESCC(C)(C1CCC(CC1)N)O.Cl

Computed by PubChem (NCBI)