Products 121491-14-3
CAS 121491-14-3 is the registry number for (R)-3-Mercapto-2-((S)-pyrrolidine-2-carboxamido)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Pro-Cys is a dipeptide obtained by formal condensation of the carboxy group of L-proline acid with the amino group of L-cysteine. It is functionally related to a L-proline and a L-cysteine.
Source: ChEBI
| Molecular formula | C8H14N2O3S |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | (2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoic acid |
| InChIKey | HXNYBZQLBWIADP-WDSKDSINSA-N |
| SMILES | C1C[C@H](NC1)C(=O)N[C@@H](CS)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
L-Prolyl-L-Cysteine, Pro-Cys, (2R)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-3-sulanylpropanoic acid, (2R)-2-(((2S)-pyrrolidine-2-carbonyl)amino)-3-sulanylpropanoic acid, H-Pro-Cys-OH, L-Pro-L-Cys, P-S dipeptide, PS Dipeptide, (R)-3-Mercapto-2-((S)-pyrrolidine-2-carboxamido)propanoic acid, prolyl-cysteine