CAS 1215205-78-9 appears in our catalog under these names: Ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate, 98%, ethyl 2–(3–chloro–2–fluorophenyl)–2,2–difluoroacetate, Ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate, Ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate, 91%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
Ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate (CAS 1215205-78-9) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate. InChIKey: LCEUDNYLGVZEHQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate |
| InChIKey | LCEUDNYLGVZEHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C(=CC=C1)Cl)F)(F)F |
Computed by PubChem (NCBI)