CAS 1215206-51-1 is the registry number for 1-(Cbz-Amino)-4-bromonaphthalene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
Benzyl N-(4-bromonaphthalen-1-yl)carbamate (CAS 1215206-51-1) is a chemical compound with the molecular formula C18H14BrNO2 and a molecular weight of 356.2 g/mol. IUPAC name: benzyl N-(4-bromonaphthalen-1-yl)carbamate. InChIKey: YTEZGWHQCCNKET-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNO2 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | benzyl N-(4-bromonaphthalen-1-yl)carbamate |
| InChIKey | YTEZGWHQCCNKET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C3=CC=CC=C32)Br |
Computed by PubChem (NCBI)