CAS 445260-10-6 appears in our catalog under these names: 2-(3-Bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(3-Bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid (CAS 445260-10-6) is a chemical compound with the molecular formula C18H14BrNO2 and a molecular weight of 356.2 g/mol. IUPAC name: 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: DEMODZFUXXBGSV-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNO2 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | DEMODZFUXXBGSV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC(=CC=C3)Br)C(=O)O)C |
Computed by PubChem (NCBI)