CAS 351000-02-7 appears in our catalog under these names: 6-Bromo-3-methyl-2-4-tolylquinoline-4-carboxylic acid, 95%, 95%, 6-Bromo-3-methyl-2-p-tolylquinoline-4-carboxylic acid, 95%, 6-Bromo-3-Methyl-2-(p-tolyl)quinoline-4-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 2g.
6-bromo-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylic acid (CAS 351000-02-7) is a chemical compound with the molecular formula C18H14BrNO2 and a molecular weight of 356.2 g/mol. IUPAC name: 6-bromo-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylic acid. InChIKey: IJKOKQJXLDYBKI-UHFFFAOYSA-N.
| Molecular formula | C18H14BrNO2 |
|---|---|
| Molecular weight | 356.2 g/mol |
| IUPAC name | 6-bromo-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | IJKOKQJXLDYBKI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2C)C(=O)O |
Computed by PubChem (NCBI)