Products 1215295-94-5
CAS 1215295-94-5 appears in our catalog under these names: 3-(3-Chloro-1h-1,2,4-triazol-5-yl)pyridine, 95%, 3-(3-Chloro-1H-1,2,4-triazol-5-yl)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(5-chloro-1H-1,2,4-triazol-3-yl)pyridine (CAS 1215295-94-5) is a chemical compound with the molecular formula C7H5ClN4 and a molecular weight of 180.59 g/mol. IUPAC name: 3-(5-chloro-1H-1,2,4-triazol-3-yl)pyridine. InChIKey: DWOKDZBWMQJAGA-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-(5-chloro-1H-1,2,4-triazol-3-yl)pyridine |
| InChIKey | DWOKDZBWMQJAGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NNC(=N2)Cl |
Computed by PubChem (NCBI)