CAS 941294-48-0 appears in our catalog under these names: 2-Chloro-6-(imidazol-1-yl)pyrazine, 98%, 2-Chloro-6-(imidazol-1-yl)pyrazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 1g, 5g, 2,5g.
2-chloro-6-imidazol-1-ylpyrazine (CAS 941294-48-0) is a chemical compound with the molecular formula C7H5ClN4 and a molecular weight of 180.59 g/mol. IUPAC name: 2-chloro-6-imidazol-1-ylpyrazine. InChIKey: HHEPEXVSWGTIPS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 2-chloro-6-imidazol-1-ylpyrazine |
| InChIKey | HHEPEXVSWGTIPS-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)