Products 1215297-26-9

CAS 1215297-26-9 is the registry number for 1-((4-Methoxyphenyl)sulfonyl)-1H-pyrrole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(4-methoxyphenyl)sulfonylpyrrole-3-carboxylic acid (CAS 1215297-26-9) is a chemical compound with the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. IUPAC name: 1-(4-methoxyphenyl)sulfonylpyrrole-3-carboxylic acid. InChIKey: PQSGSPQXNNLDNA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO5S
Molecular weight281.29 g/mol
IUPAC name1-(4-methoxyphenyl)sulfonylpyrrole-3-carboxylic acid
InChIKeyPQSGSPQXNNLDNA-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)C(=O)O

Computed by PubChem (NCBI)