CAS 6361-41-7 is the registry number for 6-Acetamido-4-hydroxy-2-naphthalenesulfonic Acid. Offered by: TRC. Available pack sizes: 5g.
6-acetamido-4-hydroxynaphthalene-2-sulfonic acid (CAS 6361-41-7) is a chemical compound with the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. IUPAC name: 6-acetamido-4-hydroxynaphthalene-2-sulfonic acid. InChIKey: YKVBYISUDGOVDM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5S |
|---|---|
| Molecular weight | 281.29 g/mol |
| IUPAC name | 6-acetamido-4-hydroxynaphthalene-2-sulfonic acid |
| InChIKey | YKVBYISUDGOVDM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C(C=C2C=C1)S(=O)(=O)O)O |
Computed by PubChem (NCBI)