CAS 603118-18-9 appears in our catalog under these names: 3-([(2-Furylmethyl)amino]sulfonyl)benzoic acid, 95%, 3-(N-(Furan-2-ylmethyl)sulfamoyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-(furan-2-ylmethylsulfamoyl)benzoic acid (CAS 603118-18-9) is a chemical compound with the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. IUPAC name: 3-(furan-2-ylmethylsulfamoyl)benzoic acid. InChIKey: WGFFBVJRQFLJBY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5S |
|---|---|
| Molecular weight | 281.29 g/mol |
| IUPAC name | 3-(furan-2-ylmethylsulfamoyl)benzoic acid |
| InChIKey | WGFFBVJRQFLJBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NCC2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)