Products 1215336-37-0
CAS 1215336-37-0 is the registry number for 3,4-Dihydro-7-hydroxyquinoline-2(1H)-one-d6. Offered by: TRC. Available pack sizes: 100mg.
3,3,4,4,6,8-hexadeuterio-7-hydroxy-1H-quinolin-2-one (CAS 1215336-37-0) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 169.21 g/mol. IUPAC name: 3,3,4,4,6,8-hexadeuterio-7-hydroxy-1H-quinolin-2-one. InChIKey: LKLSFDWYIBUGNT-NICLLADASA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 169.21 g/mol |
| IUPAC name | 3,3,4,4,6,8-hexadeuterio-7-hydroxy-1H-quinolin-2-one |
| InChIKey | LKLSFDWYIBUGNT-NICLLADASA-N |
| SMILES | [2H]C1=CC2=C(C(=C1O)[2H])NC(=O)C(C2([2H])[2H])([2H])[2H] |
Computed by PubChem (NCBI)