CAS 1215365-11-9 is the registry number for 4–Acetoxy–N–isopropyl–N–methyltryptamine–d4. Offered by: GLPBio. Available pack sizes: 50mg.
[3-[1,1,2,2-tetradeuterio-2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate (CAS 1215365-11-9) is a chemical compound with the molecular formula C16H22N2O2 and a molecular weight of 278.38 g/mol. IUPAC name: [3-[1,1,2,2-tetradeuterio-2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate. InChIKey: CIDMXLOVFPIHDS-LZMSFWOYSA-N.
| Molecular formula | C16H22N2O2 |
|---|---|
| Molecular weight | 278.38 g/mol |
| IUPAC name | [3-[1,1,2,2-tetradeuterio-2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-yl] acetate |
| InChIKey | CIDMXLOVFPIHDS-LZMSFWOYSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C(=CC=C2)OC(=O)C)C([2H])([2H])N(C)C(C)C |
Computed by PubChem (NCBI)