Products 20846-91-7
CAS 20846-91-7 appears in our catalog under these names: (S,S)-Ethylenediamine-N,N''-disuccinic acid, 80.00%, (S,S)-EDDS, 98.0%, N,N'-Ethylenediamine disuccinic acid, 95%, (2S,2'S)-2,2'-(Ethane-1,2-diylbis(azanediyl))disuccinic acid, 95%. Offered by: Chemat, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 100g, 25g, 1 g, 500 mg, 100 mg, 50 mg, 5g, 10g.
(2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid (CAS 20846-91-7) is a chemical compound with the molecular formula C10H16N2O8 and a molecular weight of 292.24 g/mol. IUPAC name: (2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid. InChIKey: VKZRWSNIWNFCIQ-WDSKDSINSA-N.
| Molecular formula | C10H16N2O8 |
|---|---|
| Molecular weight | 292.24 g/mol |
| IUPAC name | (2S)-2-[2-[[(1S)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid |
| InChIKey | VKZRWSNIWNFCIQ-WDSKDSINSA-N |
| SMILES | C(CN[C@@H](CC(=O)O)C(=O)O)N[C@@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)