Products 1215460-35-7
CAS 1215460-35-7 appears in our catalog under these names: Isobutyl-d9 Paraben, >95% (HPLC), Isobutyl-d9 paraben. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 100mg.
[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl] 4-hydroxybenzoate (CAS 1215460-35-7) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 203.28 g/mol. IUPAC name: [1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl] 4-hydroxybenzoate. InChIKey: XPJVKCRENWUEJH-GVZYGMFYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | [1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propyl] 4-hydroxybenzoate |
| InChIKey | XPJVKCRENWUEJH-GVZYGMFYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])OC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)