CAS 1219805-33-0 appears in our catalog under these names: iso-Butyl 4-Hydroxybenzoate-2,3,5,6-d4, iso-Butyl 4-Hydroxybenzoate-2,3,5,6-d4, >95% (HPLC), iso-Butyl 4-Hydroxybenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, 4-Hydroxybenzoic acid-isobutyl ester D4 (ring D4), Isobutylparaben-d4, 98.5%. Offered by: Chemat Brand, TRC, CDN, Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2mg, 0,1g, 0,05g, 10 mg, 5 mg.
2-methylpropyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate (CAS 1219805-33-0) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 198.25 g/mol. IUPAC name: 2-methylpropyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate. InChIKey: XPJVKCRENWUEJH-LNFUJOGGSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 198.25 g/mol |
| IUPAC name | 2-methylpropyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| InChIKey | XPJVKCRENWUEJH-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCC(C)C)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)