CAS 1215631-57-4 appears in our catalog under these names: Iprodione-d5, Iprodione-d5 (3,5-dichlorophenyl-2,4,6-d3, hydantoin-5,5-d2), 97 atom % D, min 98% Chemical Purity, D5-Iprodione, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, CDN, Biosynth, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 2,5mg, 0,01g, 0,005g, 5mg, 25mg, 50mg.
5,5-dideuterio-3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide (CAS 1215631-57-4) is a chemical compound with the molecular formula C13H13Cl2N3O3 and a molecular weight of 335.19 g/mol. IUPAC name: 5,5-dideuterio-3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide. InChIKey: ONUFESLQCSAYKA-VVHGGLIRSA-N.
| Molecular formula | C13H13Cl2N3O3 |
|---|---|
| Molecular weight | 335.19 g/mol |
| IUPAC name | 5,5-dideuterio-3-(3,5-dichloro-2,4,6-trideuteriophenyl)-2,4-dioxo-N-propan-2-ylimidazolidine-1-carboxamide |
| InChIKey | ONUFESLQCSAYKA-VVHGGLIRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)[2H])Cl)[2H])N2C(=O)C(N(C2=O)C(=O)NC(C)C)([2H])[2H] |
Computed by PubChem (NCBI)