CAS 67914-85-6 appears in our catalog under these names: Itraconazole Impurity 13, Itraconazole Impurity 53, Itraconazole Impurity 30, cis-2-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolane-4-methanol, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol (CAS 67914-85-6) is a chemical compound with the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.16 g/mol. IUPAC name: [(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol. InChIKey: NKUOWQPBYUKRIM-ZWNOBZJWSA-N.
| Molecular formula | C13H13Cl2N3O3 |
|---|---|
| Molecular weight | 330.16 g/mol |
| IUPAC name | [(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol |
| InChIKey | NKUOWQPBYUKRIM-ZWNOBZJWSA-N |
| SMILES | C1[C@H](O[C@](O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl)CO |
Computed by PubChem (NCBI)