Products 172587-60-9
CAS 172587-60-9 is the registry number for Itraconazole Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol (CAS 172587-60-9) is a chemical compound with the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.16 g/mol. IUPAC name: [(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol. InChIKey: NKUOWQPBYUKRIM-ZWNOBZJWSA-N.
| Molecular formula | C13H13Cl2N3O3 |
|---|---|
| Molecular weight | 330.16 g/mol |
| IUPAC name | [(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol |
| InChIKey | NKUOWQPBYUKRIM-ZWNOBZJWSA-N |
| SMILES | C1[C@H](O[C@](O1)(CN2C=NC=N2)C3=C(C=C(C=C3)Cl)Cl)CO |
Computed by PubChem (NCBI)