Products 1215642-98-0
CAS 1215642-98-0 is the registry number for 1-(1-(4-Fluorophenyl)ethyl)-5-oxopyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-[1-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 1215642-98-0) is a chemical compound with the molecular formula C13H14FNO3 and a molecular weight of 251.25 g/mol. IUPAC name: 1-[1-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: PEAZNJDTYKKTFE-UHFFFAOYSA-N.
| Molecular formula | C13H14FNO3 |
|---|---|
| Molecular weight | 251.25 g/mol |
| IUPAC name | 1-[1-(4-fluorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | PEAZNJDTYKKTFE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)F)N2CC(CC2=O)C(=O)O |
Computed by PubChem (NCBI)