CAS 1215646-82-4 appears in our catalog under these names: Diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione dihydrochloride, 98%, Diimidazo(1,5-a:1',5'-d)pyrazine-5,10-dione dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione;dihydrochloride (CAS 1215646-82-4) is a chemical compound with the molecular formula C8H6Cl2N4O2 and a molecular weight of 261.06 g/mol. IUPAC name: 1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione;dihydrochloride. InChIKey: JDFOVNMCCJAZEY-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4O2 |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | 1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodeca-3,5,9,11-tetraene-2,8-dione;dihydrochloride |
| InChIKey | JDFOVNMCCJAZEY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=O)N3C=NC=C3C(=O)N2C=N1.Cl.Cl |
Computed by PubChem (NCBI)