CAS 862374-04-7 is the registry number for Methyl 2-(2,6-dichloro-9H-purin-9-yl)acetate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-(2,6-dichloropurin-9-yl)acetate (CAS 862374-04-7) is a chemical compound with the molecular formula C8H6Cl2N4O2 and a molecular weight of 261.06 g/mol. IUPAC name: methyl 2-(2,6-dichloropurin-9-yl)acetate. InChIKey: CYFDDQDGJBCBOV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4O2 |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | methyl 2-(2,6-dichloropurin-9-yl)acetate |
| InChIKey | CYFDDQDGJBCBOV-UHFFFAOYSA-N |
| SMILES | COC(=O)CN1C=NC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)