CAS 2089972-52-9 appears in our catalog under these names: Ethyl 2,6-dichloro-9H-purine-8-carboxylate, 98%, Ethyl 2,6-dichloro-9H-purine-8-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg, 0,5g, 50mg.
Ethyl 2,6-dichloro-7H-purine-8-carboxylate (CAS 2089972-52-9) is a chemical compound with the molecular formula C8H6Cl2N4O2 and a molecular weight of 261.06 g/mol. IUPAC name: ethyl 2,6-dichloro-7H-purine-8-carboxylate. InChIKey: ALDFCVOYZYHPND-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4O2 |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | ethyl 2,6-dichloro-7H-purine-8-carboxylate |
| InChIKey | ALDFCVOYZYHPND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)