CAS 1215738-07-0 is the registry number for 2-Propenyl-(propyl-d7)-propanedioic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Diethyl 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-2-prop-2-enylpropanedioate (CAS 1215738-07-0) is a chemical compound with the molecular formula C13H22O4 and a molecular weight of 249.35 g/mol. IUPAC name: diethyl 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-2-prop-2-enylpropanedioate. InChIKey: KELSEWGOVCFKMN-GQEKAPENSA-N.
| Molecular formula | C13H22O4 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | diethyl 2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-2-prop-2-enylpropanedioate |
| InChIKey | KELSEWGOVCFKMN-GQEKAPENSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(CC=C)(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)