Products 59726-38-4

CAS 59726-38-4 is the registry number for 2-Propenylpropylpropanedioic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Diethyl 2-prop-2-enyl-2-propylpropanedioate (CAS 59726-38-4) is a chemical compound with the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. IUPAC name: diethyl 2-prop-2-enyl-2-propylpropanedioate. InChIKey: KELSEWGOVCFKMN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22O4
Molecular weight242.31 g/mol
IUPAC namediethyl 2-prop-2-enyl-2-propylpropanedioate
InChIKeyKELSEWGOVCFKMN-UHFFFAOYSA-N
SMILESCCCC(CC=C)(C(=O)OCC)C(=O)OCC

Computed by PubChem (NCBI)