CAS 60866-47-9 is the registry number for A-Factor. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, Get quote.
(3S,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one (CAS 60866-47-9) is a chemical compound with the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. IUPAC name: (3S,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one. InChIKey: REAWNMHCBIUKLZ-PWSUYJOCSA-N.
| Molecular formula | C13H22O4 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | (3S,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one |
| InChIKey | REAWNMHCBIUKLZ-PWSUYJOCSA-N |
| SMILES | CC(C)CCCCC(=O)[C@@H]1[C@@H](COC1=O)CO |
Computed by PubChem (NCBI)