CAS 1215752-28-5 appears in our catalog under these names: 4-((7-Chloro-4-quinolinyl)amino)-1-pentanol-d4, 4-[(7-Chloro-4-quinolinyl)amino]-1-pentanol-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentan-1-ol (CAS 1215752-28-5) is a chemical compound with the molecular formula C14H17ClN2O and a molecular weight of 268.77 g/mol. IUPAC name: 4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentan-1-ol. InChIKey: BZUKCXDUDOUBKN-IJPFRAOOSA-N.
| Molecular formula | C14H17ClN2O |
|---|---|
| Molecular weight | 268.77 g/mol |
| IUPAC name | 4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentan-1-ol |
| InChIKey | BZUKCXDUDOUBKN-IJPFRAOOSA-N |
| SMILES | [2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])O |
Computed by PubChem (NCBI)