Products 51980-53-1
CAS 51980-53-1 is the registry number for 5-Chloroacetamido-2-methylene-1,3,3-trimethylindoline. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-chloro-N-(1,3,3-trimethyl-2-methylideneindol-5-yl)acetamide (CAS 51980-53-1) is a chemical compound with the molecular formula C14H17ClN2O and a molecular weight of 264.75 g/mol. IUPAC name: 2-chloro-N-(1,3,3-trimethyl-2-methylideneindol-5-yl)acetamide. InChIKey: LQAYFOAWQOGESO-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O |
|---|---|
| Molecular weight | 264.75 g/mol |
| IUPAC name | 2-chloro-N-(1,3,3-trimethyl-2-methylideneindol-5-yl)acetamide |
| InChIKey | LQAYFOAWQOGESO-UHFFFAOYSA-N |
| SMILES | CC1(C(=C)N(C2=C1C=C(C=C2)NC(=O)CCl)C)C |
Computed by PubChem (NCBI)