CAS 1275714-85-6 is the registry number for (1-(4-Chlorophenyl)ethyl)((dimethyl-1,3-oxazol-2-yl)methyl)amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(4-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine (CAS 1275714-85-6) is a chemical compound with the molecular formula C14H17ClN2O and a molecular weight of 264.75 g/mol. IUPAC name: 1-(4-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine. InChIKey: JUYVDPQBRHYWRL-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O |
|---|---|
| Molecular weight | 264.75 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine |
| InChIKey | JUYVDPQBRHYWRL-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)CNC(C)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)