CAS 1215780-15-6 appears in our catalog under these names: Anastrozole Impurity 6(EP Impurity A), 2-(3-((1H-1,2,4-Triazol-1-yl)methyl)-5-(1-cyanoethyl)phenyl)-2-methylpropanenitrile, 98%, Anastrozole EP Impurity A, a-Desmethyl Anastrozole(>90%), 2-(3-((1RS)-1-Cyanoethyl)-5-(1H-1,2,4-triazol-1-ylmethyl)phenyl)-2-methylpropanenitrile. Offered by: Hubei YoungXin, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1mg, 2mg.
2-[3-(1-cyanoethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile (CAS 1215780-15-6) is a chemical compound with the molecular formula C16H17N5 and a molecular weight of 279.34 g/mol. IUPAC name: 2-[3-(1-cyanoethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile. InChIKey: LXXANTDQIIXQBZ-UHFFFAOYSA-N.
| Molecular formula | C16H17N5 |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 2-[3-(1-cyanoethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
| InChIKey | LXXANTDQIIXQBZ-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(C)C#N |
Computed by PubChem (NCBI)