Products 1346601-01-1
CAS 1346601-01-1 appears in our catalog under these names: alpha-Desmethyl Anastrozole-d3, α-Desmethyl anastrozole-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, Get quote.
2-[3-(1-cyano-2,2,2-trideuterioethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile (CAS 1346601-01-1) is a chemical compound with the molecular formula C16H17N5 and a molecular weight of 282.36 g/mol. IUPAC name: 2-[3-(1-cyano-2,2,2-trideuterioethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile. InChIKey: LXXANTDQIIXQBZ-FIBGUPNXSA-N.
| Molecular formula | C16H17N5 |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 2-[3-(1-cyano-2,2,2-trideuterioethyl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
| InChIKey | LXXANTDQIIXQBZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(C)C#N |
Computed by PubChem (NCBI)
Synonyms:
alpha-Desmethyl Anastrozole-d3