CAS 301328-20-1 is the registry number for 6-(3,5-Dimethyl-1H-pyrazol-1-yl)-N-(p-tolyl)pyrimidin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)pyrimidin-4-amine (CAS 301328-20-1) is a chemical compound with the molecular formula C16H17N5 and a molecular weight of 279.34 g/mol. IUPAC name: 6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)pyrimidin-4-amine. InChIKey: JFEKPMKGHSALHL-UHFFFAOYSA-N.
| Molecular formula | C16H17N5 |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)pyrimidin-4-amine |
| InChIKey | JFEKPMKGHSALHL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC(=NC=N2)N3C(=CC(=N3)C)C |
Computed by PubChem (NCBI)