Products 1215780-28-1
CAS 1215780-28-1 is the registry number for 3-Methyl-(1,2,4)triazolo(4,3-a)pyridine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid (CAS 1215780-28-1) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid. InChIKey: USTDMISXTWJATE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid |
| InChIKey | USTDMISXTWJATE-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)