CAS 1215898-30-8 appears in our catalog under these names: 4-Hydroxy-3-methoxy-Alpha-((methyl-d3-amino)methyl)benzenemethanol, 4-Hydroxy-3-methoxy-a-((methyl-d3-amino)methyl)benzenemethanol. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]-2-methoxyphenol (CAS 1215898-30-8) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 200.25 g/mol. IUPAC name: 4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]-2-methoxyphenol. InChIKey: JWJCTZKFYGDABJ-FIBGUPNXSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 200.25 g/mol |
| IUPAC name | 4-[1-hydroxy-2-(trideuteriomethylamino)ethyl]-2-methoxyphenol |
| InChIKey | JWJCTZKFYGDABJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC(=C(C=C1)O)OC)O |
Computed by PubChem (NCBI)