CAS 1215921-77-9 appears in our catalog under these names: Methyl 2-amino-3-fluoro-6-methylbenzoate, 95%, Methyl 2-amino-3-fluoro-6-methylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 2-amino-3-fluoro-6-methylbenzoate (CAS 1215921-77-9) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: methyl 2-amino-3-fluoro-6-methylbenzoate. InChIKey: DTDYEYUKTBXHOC-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | methyl 2-amino-3-fluoro-6-methylbenzoate |
| InChIKey | DTDYEYUKTBXHOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)N)C(=O)OC |
Computed by PubChem (NCBI)